CAS 136818-65-0 appears in our catalog under these names: 5-Fluoro-6-methoxy-1H-indole-2-carboxylic acid, 97%, 5-fluoro-6-methoxy-1H-indole-2-carboxylic acid, 95%, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
5-fluoro-6-methoxy-1H-indole-2-carboxylic acid (CAS 136818-65-0) is a chemical compound with the molecular formula C10H8FNO3 and a molecular weight of 209.17 g/mol. IUPAC name: 5-fluoro-6-methoxy-1H-indole-2-carboxylic acid. InChIKey: YRFANAUFECXLOZ-UHFFFAOYSA-N.
| Molecular formula | C10H8FNO3 |
|---|---|
| Molecular weight | 209.17 g/mol |
| IUPAC name | 5-fluoro-6-methoxy-1H-indole-2-carboxylic acid |
| InChIKey | YRFANAUFECXLOZ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C=C(NC2=C1)C(=O)O)F |
Computed by PubChem (NCBI)