CAS 1368308-27-3 appears in our catalog under these names: Methyl 4-(3,4-dichlorophenyl)butanoate, 95%, Methyl 4-(3,4-dichlorophenyl)butanoate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Methyl 4-(3,4-dichlorophenyl)butanoate (CAS 1368308-27-3) is a chemical compound with the molecular formula C11H12Cl2O2 and a molecular weight of 247.11 g/mol. IUPAC name: methyl 4-(3,4-dichlorophenyl)butanoate. InChIKey: LZOFSZPLOMWNCR-UHFFFAOYSA-N.
| Molecular formula | C11H12Cl2O2 |
|---|---|
| Molecular weight | 247.11 g/mol |
| IUPAC name | methyl 4-(3,4-dichlorophenyl)butanoate |
| InChIKey | LZOFSZPLOMWNCR-UHFFFAOYSA-N |
| SMILES | COC(=O)CCCC1=CC(=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)