CAS 1368387-49-8 is the registry number for 4-(5-(Trifluoromethyl)-4H-1,2,4-triazol-3-yl)aniline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]aniline (CAS 1368387-49-8) is a chemical compound with the molecular formula C9H7F3N4 and a molecular weight of 228.17 g/mol. IUPAC name: 4-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]aniline. InChIKey: SUFSGDSBJGIRHD-UHFFFAOYSA-N.
| Molecular formula | C9H7F3N4 |
|---|---|
| Molecular weight | 228.17 g/mol |
| IUPAC name | 4-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]aniline |
| InChIKey | SUFSGDSBJGIRHD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NNC(=N2)C(F)(F)F)N |
Computed by PubChem (NCBI)