CAS 874607-04-2 appears in our catalog under these names: 5-([4-(Trifluoromethyl)phenyl]methyl)-2h-1,2,3,4-tetrazole, 95%, 5-{[4-(trifluoromethyl)phenyl]methyl}-2h-1,2,3,4-tetrazole, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
5-[[4-(trifluoromethyl)phenyl]methyl]-2H-tetrazole (CAS 874607-04-2) is a chemical compound with the molecular formula C9H7F3N4 and a molecular weight of 228.17 g/mol. IUPAC name: 5-[[4-(trifluoromethyl)phenyl]methyl]-2H-tetrazole. InChIKey: CGKUXXKMSFJBQY-UHFFFAOYSA-N.
| Molecular formula | C9H7F3N4 |
|---|---|
| Molecular weight | 228.17 g/mol |
| IUPAC name | 5-[[4-(trifluoromethyl)phenyl]methyl]-2H-tetrazole |
| InChIKey | CGKUXXKMSFJBQY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC2=NNN=N2)C(F)(F)F |
Computed by PubChem (NCBI)