CAS 1476087-29-2 is the registry number for 1-(2-(Trifluoromethyl)phenyl)-1H-1,2,3-triazol-4-amine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-[2-(trifluoromethyl)phenyl]triazol-4-amine (CAS 1476087-29-2) is a chemical compound with the molecular formula C9H7F3N4 and a molecular weight of 228.17 g/mol. IUPAC name: 1-[2-(trifluoromethyl)phenyl]triazol-4-amine. InChIKey: KXKYZASJQFHMHQ-UHFFFAOYSA-N.
| Molecular formula | C9H7F3N4 |
|---|---|
| Molecular weight | 228.17 g/mol |
| IUPAC name | 1-[2-(trifluoromethyl)phenyl]triazol-4-amine |
| InChIKey | KXKYZASJQFHMHQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(F)(F)F)N2C=C(N=N2)N |
Computed by PubChem (NCBI)