CAS 890302-19-9 is the registry number for 5-Hydrazino-2-(trifluoromethyl)-1,6-naphthyridine, 95%. Offered by: Fluorochem. Available pack sizes: 1g, 5g.
[2-(trifluoromethyl)-1,6-naphthyridin-5-yl]hydrazine (CAS 890302-19-9) is a chemical compound with the molecular formula C9H7F3N4 and a molecular weight of 228.17 g/mol. IUPAC name: [2-(trifluoromethyl)-1,6-naphthyridin-5-yl]hydrazine. InChIKey: IUGJAKZOWJXVNR-UHFFFAOYSA-N.
| Molecular formula | C9H7F3N4 |
|---|---|
| Molecular weight | 228.17 g/mol |
| IUPAC name | [2-(trifluoromethyl)-1,6-naphthyridin-5-yl]hydrazine |
| InChIKey | IUGJAKZOWJXVNR-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1C(=NC=C2)NN)C(F)(F)F |
Computed by PubChem (NCBI)