CAS 178556-79-1 is the registry number for 5-(4-(Trifluoromethyl)phenyl)-4H-1,2,4-triazol-3-amine, 95%. Offered by: AmBeed. Available pack sizes: 1g.
5-[4-(trifluoromethyl)phenyl]-1H-1,2,4-triazol-3-amine (CAS 178556-79-1) is a chemical compound with the molecular formula C9H7F3N4 and a molecular weight of 228.17 g/mol. IUPAC name: 5-[4-(trifluoromethyl)phenyl]-1H-1,2,4-triazol-3-amine. InChIKey: OPCMOBZOGLGRKI-UHFFFAOYSA-N.
| Molecular formula | C9H7F3N4 |
|---|---|
| Molecular weight | 228.17 g/mol |
| IUPAC name | 5-[4-(trifluoromethyl)phenyl]-1H-1,2,4-triazol-3-amine |
| InChIKey | OPCMOBZOGLGRKI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC(=NN2)N)C(F)(F)F |
Computed by PubChem (NCBI)