CAS 438019-67-1 appears in our catalog under these names: 2-[1,2,4]Triazol-1-yl-5-trifluoromethyl-phenylamine, 95%, 2-(1H-1,2,4-Triazol-1-yl)-5-(trifluoromethyl)aniline. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 250mg, 10g, 0,5g.
2-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)aniline (CAS 438019-67-1) is a chemical compound with the molecular formula C9H7F3N4 and a molecular weight of 228.17 g/mol. IUPAC name: 2-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)aniline. InChIKey: IELXEIUQSUFWOK-UHFFFAOYSA-N.
| Molecular formula | C9H7F3N4 |
|---|---|
| Molecular weight | 228.17 g/mol |
| IUPAC name | 2-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)aniline |
| InChIKey | IELXEIUQSUFWOK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)N)N2C=NC=N2 |
Computed by PubChem (NCBI)