CAS 351325-27-4 is the registry number for 4-(1H-1,2,4-Triazol-1-yl)-3-(trifluoromethyl)aniline. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
4-(1,2,4-triazol-1-yl)-3-(trifluoromethyl)aniline (CAS 351325-27-4) is a chemical compound with the molecular formula C9H7F3N4 and a molecular weight of 228.17 g/mol. IUPAC name: 4-(1,2,4-triazol-1-yl)-3-(trifluoromethyl)aniline. InChIKey: JZVZWJBLEPZALK-UHFFFAOYSA-N.
| Molecular formula | C9H7F3N4 |
|---|---|
| Molecular weight | 228.17 g/mol |
| IUPAC name | 4-(1,2,4-triazol-1-yl)-3-(trifluoromethyl)aniline |
| InChIKey | JZVZWJBLEPZALK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)C(F)(F)F)N2C=NC=N2 |
Computed by PubChem (NCBI)