CAS 1368659-05-5 is the registry number for 6-Amino-2-methyl-4H-3,1-benzoxazin-4-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-amino-2-methyl-3,1-benzoxazin-4-one (CAS 1368659-05-5) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: 6-amino-2-methyl-3,1-benzoxazin-4-one. InChIKey: VSFHEZQFGUMKRT-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 6-amino-2-methyl-3,1-benzoxazin-4-one |
| InChIKey | VSFHEZQFGUMKRT-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C(C=C2)N)C(=O)O1 |
Computed by PubChem (NCBI)