CAS 1391405-13-2 appears in our catalog under these names: Methyl (S)-3-amino-3-(pyridin-4-yl)propanoate dihydrochloride, 95%, 95%, METHYL (S)-3-AMINO-3-(PYRIDIN-4-YL)PROPANOATE DIHYDROCHLORIDE, 95%, H-β-D-Ala(pyridin-4-yl)-OMe 2HCl, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.
Methyl (3S)-3-amino-3-pyridin-4-ylpropanoate;dihydrochloride (CAS 1391405-13-2) is a chemical compound with the molecular formula C9H14Cl2N2O2 and a molecular weight of 253.12 g/mol. IUPAC name: methyl (3S)-3-amino-3-pyridin-4-ylpropanoate;dihydrochloride. InChIKey: NSTORCLCXFBAKE-JZGIKJSDSA-N.
| Molecular formula | C9H14Cl2N2O2 |
|---|---|
| Molecular weight | 253.12 g/mol |
| IUPAC name | methyl (3S)-3-amino-3-pyridin-4-ylpropanoate;dihydrochloride |
| InChIKey | NSTORCLCXFBAKE-JZGIKJSDSA-N |
| SMILES | COC(=O)C[C@@H](C1=CC=NC=C1)N.Cl.Cl |
Computed by PubChem (NCBI)