Products 23340-69-4
CAS 23340-69-4 appears in our catalog under these names: Dimethyl 5-cyanoisophthalate, 95%, Dimethyl 5–Cyanoisophthalate, Dimethyl 5-cyanoisophthalate 97%, Dimethyl 5-Cyanoisophthalate, >97%, >97%, Dimethyl 5-cyanoisophthalate. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg.
Dimethyl 5-cyanobenzene-1,3-dicarboxylate (CAS 23340-69-4) is a chemical compound with the molecular formula C11H9NO4 and a molecular weight of 219.19 g/mol. IUPAC name: dimethyl 5-cyanobenzene-1,3-dicarboxylate. InChIKey: VCBJSDVXWATFEQ-UHFFFAOYSA-N.
| Molecular formula | C11H9NO4 |
|---|---|
| Molecular weight | 219.19 g/mol |
| IUPAC name | dimethyl 5-cyanobenzene-1,3-dicarboxylate |
| InChIKey | VCBJSDVXWATFEQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC(=C1)C#N)C(=O)OC |
Computed by PubChem (NCBI)