CAS 33282-16-5 appears in our catalog under these names: 5–(4–Methoxyphenyl)isoxazole–3–carboxylic acid, 5-(4-Methoxyphenyl)isoxazole-3-carboxylic acid, 95%, 5-(4-Methoxyphenyl)isoxazole-3-carboxylic acid, 98%, 98%, 5-(4-Methoxy-phenyl)-isoxazole-3-carboxylic acid, 98%, 5-(4-Methoxyphenyl)isoxazole-3-carboxylic acid, 97%. Offered by: GLPBio, Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 250mg, 100mg.
5-(4-methoxyphenyl)-1,2-oxazole-3-carboxylic acid (CAS 33282-16-5) is a chemical compound with the molecular formula C11H9NO4 and a molecular weight of 219.19 g/mol. IUPAC name: 5-(4-methoxyphenyl)-1,2-oxazole-3-carboxylic acid. InChIKey: YIQABFVYNGOELP-UHFFFAOYSA-N.
| Molecular formula | C11H9NO4 |
|---|---|
| Molecular weight | 219.19 g/mol |
| IUPAC name | 5-(4-methoxyphenyl)-1,2-oxazole-3-carboxylic acid |
| InChIKey | YIQABFVYNGOELP-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CC(=NO2)C(=O)O |
Computed by PubChem (NCBI)