CAS 1373232-54-2 is the registry number for 1,3-Dimethyl 2-(2-amino-4-cyanophenyl)propanedioate, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Dimethyl 2-(2-amino-4-cyanophenyl)propanedioate (CAS 1373232-54-2) is a chemical compound with the molecular formula C12H12N2O4 and a molecular weight of 248.23 g/mol. IUPAC name: dimethyl 2-(2-amino-4-cyanophenyl)propanedioate. InChIKey: UGHSCSGNXGMGDK-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O4 |
|---|---|
| Molecular weight | 248.23 g/mol |
| IUPAC name | dimethyl 2-(2-amino-4-cyanophenyl)propanedioate |
| InChIKey | UGHSCSGNXGMGDK-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1=C(C=C(C=C1)C#N)N)C(=O)OC |
Computed by PubChem (NCBI)