Products 1373835-05-2

CAS 1373835-05-2 is the registry number for 6-Chloro-4-hydroxy-quinoline-2-carboxylic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g.

Structural formula: {0} (CAS {1})

Methyl 6-chloro-4-oxo-1H-quinoline-2-carboxylate (CAS 1373835-05-2) is a chemical compound with the molecular formula C11H8ClNO3 and a molecular weight of 237.64 g/mol. IUPAC name: methyl 6-chloro-4-oxo-1H-quinoline-2-carboxylate. InChIKey: HESVUOITGSAKKR-UHFFFAOYSA-N.

Identity
Molecular formulaC11H8ClNO3
Molecular weight237.64 g/mol
IUPAC namemethyl 6-chloro-4-oxo-1H-quinoline-2-carboxylate
InChIKeyHESVUOITGSAKKR-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC(=O)C2=C(N1)C=CC(=C2)Cl

Computed by PubChem (NCBI)