CAS 179024-73-8 appears in our catalog under these names: 4–Chloro–8–methoxyquinoline–3–carboxylic acid, 4-Chloro-8-methoxyquinoline-3-carboxylic acid, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 50mg, 100mg, 250mg, 1g.
4-chloro-8-methoxyquinoline-3-carboxylic acid (CAS 179024-73-8) is a chemical compound with the molecular formula C11H8ClNO3 and a molecular weight of 237.64 g/mol. IUPAC name: 4-chloro-8-methoxyquinoline-3-carboxylic acid. InChIKey: QMWBLZDPQJWVRU-UHFFFAOYSA-N.
| Molecular formula | C11H8ClNO3 |
|---|---|
| Molecular weight | 237.64 g/mol |
| IUPAC name | 4-chloro-8-methoxyquinoline-3-carboxylic acid |
| InChIKey | QMWBLZDPQJWVRU-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC2=C(C(=CN=C21)C(=O)O)Cl |
Computed by PubChem (NCBI)