CAS 89204-93-3 is the registry number for methyl 5-(4-chlorophenyl)-1,3-oxazole-4-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 5-(4-chlorophenyl)-1,3-oxazole-4-carboxylate (CAS 89204-93-3) is a chemical compound with the molecular formula C11H8ClNO3 and a molecular weight of 237.64 g/mol. IUPAC name: methyl 5-(4-chlorophenyl)-1,3-oxazole-4-carboxylate. InChIKey: MGGPQBAELYVXMR-UHFFFAOYSA-N.
| Molecular formula | C11H8ClNO3 |
|---|---|
| Molecular weight | 237.64 g/mol |
| IUPAC name | methyl 5-(4-chlorophenyl)-1,3-oxazole-4-carboxylate |
| InChIKey | MGGPQBAELYVXMR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(OC=N1)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)