Products 17137-11-0

CAS 17137-11-0 appears in our catalog under these names: 3-(1,3-Dioxo-1,3-dihydro-isoindol-2-yl)-propionyl chloride, tech grade, 90%, 3-Phthalimidopropanoyl Chloride (Technical Grade), 3-(1,3-Dioxoisoindolin-2-yl)propanoyl chloride, 95%, 3-(1,3-Dioxo-1,3-dihydro-isoindol-2-yl)-propionyl chloride, 97%. Offered by: Combi-blocks, TRC, AmBeed, Fluorochem. Available pack sizes: 1g, 10g, 25g, 5g, 100mg, 250mg, 500mg.

Structural formula: {0} (CAS {1})

3-(1,3-dioxoisoindol-2-yl)propanoyl chloride (CAS 17137-11-0) is a chemical compound with the molecular formula C11H8ClNO3 and a molecular weight of 237.64 g/mol. IUPAC name: 3-(1,3-dioxoisoindol-2-yl)propanoyl chloride. InChIKey: ZEQHPUCQCWTFRP-UHFFFAOYSA-N.

Identity
Molecular formulaC11H8ClNO3
Molecular weight237.64 g/mol
IUPAC name3-(1,3-dioxoisoindol-2-yl)propanoyl chloride
InChIKeyZEQHPUCQCWTFRP-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(=O)N(C2=O)CCC(=O)Cl

Computed by PubChem (NCBI)