CAS 405923-50-4 is the registry number for 7-Chloro-4-hydroxy-8-methylquinoline-3-carboxylic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 1g.
7-chloro-8-methyl-4-oxo-1H-quinoline-3-carboxylic acid (CAS 405923-50-4) is a chemical compound with the molecular formula C11H8ClNO3 and a molecular weight of 237.64 g/mol. IUPAC name: 7-chloro-8-methyl-4-oxo-1H-quinoline-3-carboxylic acid. InChIKey: KIGXAPARJYAEQL-UHFFFAOYSA-N.
| Molecular formula | C11H8ClNO3 |
|---|---|
| Molecular weight | 237.64 g/mol |
| IUPAC name | 7-chloro-8-methyl-4-oxo-1H-quinoline-3-carboxylic acid |
| InChIKey | KIGXAPARJYAEQL-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC2=C1NC=C(C2=O)C(=O)O)Cl |
Computed by PubChem (NCBI)