CAS 1065074-27-2 is the registry number for Methyl 5-(3-chlorophenyl)isoxazole-4-carboxylate, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
Methyl 5-(3-chlorophenyl)-1,2-oxazole-4-carboxylate (CAS 1065074-27-2) is a chemical compound with the molecular formula C11H8ClNO3 and a molecular weight of 237.64 g/mol. IUPAC name: methyl 5-(3-chlorophenyl)-1,2-oxazole-4-carboxylate. InChIKey: IQMQZQIJFOAHQN-UHFFFAOYSA-N.
| Molecular formula | C11H8ClNO3 |
|---|---|
| Molecular weight | 237.64 g/mol |
| IUPAC name | methyl 5-(3-chlorophenyl)-1,2-oxazole-4-carboxylate |
| InChIKey | IQMQZQIJFOAHQN-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(ON=C1)C2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)