CAS 23598-72-3 appears in our catalog under these names: 3–(2–Chlorophenyl)–5–methylisoxazole–4–carboxylic acid, 3-(2-Chlorophenyl)-5-methylisoxazole-4-carboxylic acid, 3-(2-Chlorophenyl)-5-methylisoxazole-4-carboxylic acid, 98%, Cloxacillin EP Impurity D, 3-(2-Chlorophenyl)-5-methylisoxazole-4-carboxylic Acid, >95% (HPLC). Offered by: GLPBio, Biosynth, Combi-blocks, Chemat Brand, TRC. Available pack sizes: 25g, 5g, 500g, 250g, 10g, 100g, 1g, on request.
3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxylic acid (CAS 23598-72-3) is a chemical compound with the molecular formula C11H8ClNO3 and a molecular weight of 237.64 g/mol. IUPAC name: 3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxylic acid. InChIKey: UVEPOHNXGXVOJE-UHFFFAOYSA-N.
| Molecular formula | C11H8ClNO3 |
|---|---|
| Molecular weight | 237.64 g/mol |
| IUPAC name | 3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxylic acid |
| InChIKey | UVEPOHNXGXVOJE-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=CC=CC=C2Cl)C(=O)O |
Computed by PubChem (NCBI)