CAS 13743-14-1 appears in our catalog under these names: 5-Phenylthiazole-4-carboxylic acid, 95%, 5-Phenylthiazole-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 2,5g, 250mg.
5-phenyl-1,3-thiazole-4-carboxylic acid (CAS 13743-14-1) is a chemical compound with the molecular formula C10H7NO2S and a molecular weight of 205.23 g/mol. IUPAC name: 5-phenyl-1,3-thiazole-4-carboxylic acid. InChIKey: BIIMZWZUYMBFEV-UHFFFAOYSA-N.
| Molecular formula | C10H7NO2S |
|---|---|
| Molecular weight | 205.23 g/mol |
| IUPAC name | 5-phenyl-1,3-thiazole-4-carboxylic acid |
| InChIKey | BIIMZWZUYMBFEV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(N=CS2)C(=O)O |
Computed by PubChem (NCBI)