CAS 1376259-20-9 appears in our catalog under these names: Methyl 4-cyano-2,6-difluorobenzoate, 97%, Methyl 4-cyano-2,6-difluorobenzoate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Methyl 4-cyano-2,6-difluorobenzoate (CAS 1376259-20-9) is a chemical compound with the molecular formula C9H5F2NO2 and a molecular weight of 197.14 g/mol. IUPAC name: methyl 4-cyano-2,6-difluorobenzoate. InChIKey: JNWKZRDYQQSUFZ-UHFFFAOYSA-N.
| Molecular formula | C9H5F2NO2 |
|---|---|
| Molecular weight | 197.14 g/mol |
| IUPAC name | methyl 4-cyano-2,6-difluorobenzoate |
| InChIKey | JNWKZRDYQQSUFZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1F)C#N)F |
Computed by PubChem (NCBI)