Products 1376367-30-4

CAS 1376367-30-4 appears in our catalog under these names: 4-Methoxy-5-methylpicolinic acid hydrochloride, 95%, 4-Methoxy-5-methylpyridine-2-carboxylic acid hydrochloride, 4-Methoxy-5-methylpyridine-2-carboxylic acid hydrochloride, 95%, 95%. Offered by: Fluorochem, Biosynth, Chemat. Available pack sizes: 50mg, 100mg, 1g.

Structural formula: {0} (CAS {1})

4-methoxy-5-methylpyridine-2-carboxylic acid;hydrochloride (CAS 1376367-30-4) is a chemical compound with the molecular formula C8H10ClNO3 and a molecular weight of 203.62 g/mol. IUPAC name: 4-methoxy-5-methylpyridine-2-carboxylic acid;hydrochloride. InChIKey: QTHTYZBKSADJKQ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10ClNO3
Molecular weight203.62 g/mol
IUPAC name4-methoxy-5-methylpyridine-2-carboxylic acid;hydrochloride
InChIKeyQTHTYZBKSADJKQ-UHFFFAOYSA-N
SMILESCC1=CN=C(C=C1OC)C(=O)O.Cl

Computed by PubChem (NCBI)