Products 1378655-44-7
CAS 1378655-44-7 is the registry number for Methyl 5-cyano-2,4-difluorobenzoate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl 5-cyano-2,4-difluorobenzoate (CAS 1378655-44-7) is a chemical compound with the molecular formula C9H5F2NO2 and a molecular weight of 197.14 g/mol. IUPAC name: methyl 5-cyano-2,4-difluorobenzoate. InChIKey: XGBJOPOEUHDGJN-UHFFFAOYSA-N.
| Molecular formula | C9H5F2NO2 |
|---|---|
| Molecular weight | 197.14 g/mol |
| IUPAC name | methyl 5-cyano-2,4-difluorobenzoate |
| InChIKey | XGBJOPOEUHDGJN-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C(=C1)C#N)F)F |
Computed by PubChem (NCBI)
Synonyms:
Methyl 5-cyano-2,4-difluorobenzoate