CAS 137881-27-7 is the registry number for INH2BP. Offered by: TRC, MedChemExpress. Available pack sizes: 25mg, Get quote.
6-amino-5-iodochromen-2-one (CAS 137881-27-7) is a chemical compound with the molecular formula C9H6INO2 and a molecular weight of 287.05 g/mol. IUPAC name: 6-amino-5-iodochromen-2-one. InChIKey: WWRAFPGUBABZSD-UHFFFAOYSA-N.
| Molecular formula | C9H6INO2 |
|---|---|
| Molecular weight | 287.05 g/mol |
| IUPAC name | 6-amino-5-iodochromen-2-one |
| InChIKey | WWRAFPGUBABZSD-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)OC2=C1C(=C(C=C2)N)I |
Computed by PubChem (NCBI)