CAS 1379314-67-6 is the registry number for 2-tert-Butyl-4-chloropyrazolo(1,5-a)pyrazine. Offered by: TRC, Biosynth. Available pack sizes: 2,5g, 0,5g, 50mg.
2-tert-butyl-4-chloropyrazolo[1,5-a]pyrazine (CAS 1379314-67-6) is a chemical compound with the molecular formula C10H12ClN3 and a molecular weight of 209.67 g/mol. IUPAC name: 2-tert-butyl-4-chloropyrazolo[1,5-a]pyrazine. InChIKey: UJWAZKGBPRUMEJ-UHFFFAOYSA-N.
| Molecular formula | C10H12ClN3 |
|---|---|
| Molecular weight | 209.67 g/mol |
| IUPAC name | 2-tert-butyl-4-chloropyrazolo[1,5-a]pyrazine |
| InChIKey | UJWAZKGBPRUMEJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NN2C=CN=C(C2=C1)Cl |
Computed by PubChem (NCBI)