CAS 1379316-32-1 is the registry number for 3-Bromo-8-iodoquinoline, 97%. Offered by: AmBeed. Available pack sizes: 5g.
3-bromo-8-iodoquinoline (CAS 1379316-32-1) is a chemical compound with the molecular formula C9H5BrIN and a molecular weight of 333.95 g/mol. IUPAC name: 3-bromo-8-iodoquinoline. InChIKey: YXYLPUCFGUXVEZ-UHFFFAOYSA-N.
| Molecular formula | C9H5BrIN |
|---|---|
| Molecular weight | 333.95 g/mol |
| IUPAC name | 3-bromo-8-iodoquinoline |
| InChIKey | YXYLPUCFGUXVEZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=CN=C2C(=C1)I)Br |
Computed by PubChem (NCBI)