CAS 1379329-91-5 is the registry number for 2-Methyl-4-oxo-4H-benzo[d][1,3]oxazine-6-carbonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-methyl-4-oxo-3,1-benzoxazine-6-carbonitrile (CAS 1379329-91-5) is a chemical compound with the molecular formula C10H6N2O2 and a molecular weight of 186.17 g/mol. IUPAC name: 2-methyl-4-oxo-3,1-benzoxazine-6-carbonitrile. InChIKey: FLMCTWIVHUISJY-UHFFFAOYSA-N.
| Molecular formula | C10H6N2O2 |
|---|---|
| Molecular weight | 186.17 g/mol |
| IUPAC name | 2-methyl-4-oxo-3,1-benzoxazine-6-carbonitrile |
| InChIKey | FLMCTWIVHUISJY-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C(C=C2)C#N)C(=O)O1 |
Computed by PubChem (NCBI)