Products 714237-94-2
CAS 714237-94-2 appears in our catalog under these names: Methyl 2-cyano-5-isocyanobenzoate, 95%, Methyl 2,5-dicyanobenzoate, 95%, Methyl 2,5-dicyanobenzoate, 95+%, methyl 2,5-dicyanobenzoate. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 5g, 100mg.
Methyl 2,5-dicyanobenzoate (CAS 714237-94-2) is a chemical compound with the molecular formula C10H6N2O2 and a molecular weight of 186.17 g/mol. IUPAC name: methyl 2,5-dicyanobenzoate. InChIKey: BVUXZERFSVCPBC-UHFFFAOYSA-N.
| Molecular formula | C10H6N2O2 |
|---|---|
| Molecular weight | 186.17 g/mol |
| IUPAC name | methyl 2,5-dicyanobenzoate |
| InChIKey | BVUXZERFSVCPBC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)C#N)C#N |
Computed by PubChem (NCBI)