CAS 1566119-22-9 is the registry number for 2-Ethynylimidazo[1,2-a]pyridine-7-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-ethynylimidazo[1,2-a]pyridine-7-carboxylic acid (CAS 1566119-22-9) is a chemical compound with the molecular formula C10H6N2O2 and a molecular weight of 186.17 g/mol. IUPAC name: 2-ethynylimidazo[1,2-a]pyridine-7-carboxylic acid. InChIKey: VSJXNUXMTOURLC-UHFFFAOYSA-N.
| Molecular formula | C10H6N2O2 |
|---|---|
| Molecular weight | 186.17 g/mol |
| IUPAC name | 2-ethynylimidazo[1,2-a]pyridine-7-carboxylic acid |
| InChIKey | VSJXNUXMTOURLC-UHFFFAOYSA-N |
| SMILES | C#CC1=CN2C=CC(=CC2=N1)C(=O)O |
Computed by PubChem (NCBI)