Products 1566119-22-9

CAS 1566119-22-9 is the registry number for 2-Ethynylimidazo[1,2-a]pyridine-7-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-ethynylimidazo[1,2-a]pyridine-7-carboxylic acid (CAS 1566119-22-9) is a chemical compound with the molecular formula C10H6N2O2 and a molecular weight of 186.17 g/mol. IUPAC name: 2-ethynylimidazo[1,2-a]pyridine-7-carboxylic acid. InChIKey: VSJXNUXMTOURLC-UHFFFAOYSA-N.

Identity
Molecular formulaC10H6N2O2
Molecular weight186.17 g/mol
IUPAC name2-ethynylimidazo[1,2-a]pyridine-7-carboxylic acid
InChIKeyVSJXNUXMTOURLC-UHFFFAOYSA-N
SMILESC#CC1=CN2C=CC(=CC2=N1)C(=O)O

Computed by PubChem (NCBI)