CAS 39786-36-2 appears in our catalog under these names: Benzofuro[3,2-d]pyrimidin-4-ol, 95%, 3H-Benzo[4,5]furo[3,2-d]pyrimidin-4-one, 95%, 3H–Benzo(4,5)furo(3,2–d)pyrimidin–4–one, 3H-Benzo[4,5]furo[3,2-d]pyrimidin-4-one, 8-oxa-3,5-diazatricyclo[7.4.0.0²,â·]trideca-1(9),2(7),4,10,12-pentaen-6-one. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 5g, 1g.
3H-[1]benzofuro[3,2-d]pyrimidin-4-one (CAS 39786-36-2) is a chemical compound with the molecular formula C10H6N2O2 and a molecular weight of 186.17 g/mol. IUPAC name: 3H-[1]benzofuro[3,2-d]pyrimidin-4-one. InChIKey: PCCWPSFTRGJXEF-UHFFFAOYSA-N.
| Molecular formula | C10H6N2O2 |
|---|---|
| Molecular weight | 186.17 g/mol |
| IUPAC name | 3H-[1]benzofuro[3,2-d]pyrimidin-4-one |
| InChIKey | PCCWPSFTRGJXEF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(O2)C(=O)NC=N3 |
Computed by PubChem (NCBI)