Products 174500-89-1
CAS 174500-89-1 appears in our catalog under these names: 5-Cyano-1h-indole-3-carboxylic acid, 95%, 5-Cyano-1H-indole-3-carboxylic acid, 97%, 5-Cyano-1H-indole-3-carboxylic acid, 5-Cyano-1H-indole-3-carboxylic acid, 97%, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 10g, 5g, 250mg, 500mg.
5-cyano-1H-indole-3-carboxylic acid (CAS 174500-89-1) is a chemical compound with the molecular formula C10H6N2O2 and a molecular weight of 186.17 g/mol. IUPAC name: 5-cyano-1H-indole-3-carboxylic acid. InChIKey: PQKDHLJDXYCJRJ-UHFFFAOYSA-N.
| Molecular formula | C10H6N2O2 |
|---|---|
| Molecular weight | 186.17 g/mol |
| IUPAC name | 5-cyano-1H-indole-3-carboxylic acid |
| InChIKey | PQKDHLJDXYCJRJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C#N)C(=CN2)C(=O)O |
Computed by PubChem (NCBI)