CAS 889942-85-2 appears in our catalog under these names: 3-Cyano-1h-indole-4-carboxylic acid, 98%, 3-Cyano-1H-indole-4-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 0,5g.
3-cyano-1H-indole-4-carboxylic acid (CAS 889942-85-2) is a chemical compound with the molecular formula C10H6N2O2 and a molecular weight of 186.17 g/mol. IUPAC name: 3-cyano-1H-indole-4-carboxylic acid. InChIKey: PWVNJBVXUPJABL-UHFFFAOYSA-N.
| Molecular formula | C10H6N2O2 |
|---|---|
| Molecular weight | 186.17 g/mol |
| IUPAC name | 3-cyano-1H-indole-4-carboxylic acid |
| InChIKey | PWVNJBVXUPJABL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)NC=C2C#N)C(=O)O |
Computed by PubChem (NCBI)