Products 1427502-44-0
CAS 1427502-44-0 appears in our catalog under these names: 4-Cyano-1h-indole-6-carboxylic acid, 95%, 4–Cyano–1H–indole–6–carboxylic acid, 4-Cyano-1H-indole-6-carboxylic acid 95%, 4-cyano-1H-indole-6-carboxylic acid, 95%, 95%, 4-CYANO-1H-INDOLE-6-CARBOXYLIC ACID, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g.
4-cyano-1H-indole-6-carboxylic acid (CAS 1427502-44-0) is a chemical compound with the molecular formula C10H6N2O2 and a molecular weight of 186.17 g/mol. IUPAC name: 4-cyano-1H-indole-6-carboxylic acid. InChIKey: UEYYLWAXGUNAKY-UHFFFAOYSA-N.
| Molecular formula | C10H6N2O2 |
|---|---|
| Molecular weight | 186.17 g/mol |
| IUPAC name | 4-cyano-1H-indole-6-carboxylic acid |
| InChIKey | UEYYLWAXGUNAKY-UHFFFAOYSA-N |
| SMILES | C1=CNC2=CC(=CC(=C21)C#N)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
1H-Indole-6-carboxylic acid, 4-cyano-