CAS 1379345-56-8 is the registry number for 2-Amino-4,6-dimethoxybenzaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-amino-4,6-dimethoxybenzaldehyde (CAS 1379345-56-8) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: 2-amino-4,6-dimethoxybenzaldehyde. InChIKey: COAXIOJDOLFZBM-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | 2-amino-4,6-dimethoxybenzaldehyde |
| InChIKey | COAXIOJDOLFZBM-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)OC)C=O)N |
Computed by PubChem (NCBI)