Products 1379370-60-1
CAS 1379370-60-1 is the registry number for 1-bromo-3,5-bis(difluoromethyl)benzene, 97%. Offered by: Chemat. Available pack sizes: 10mg, 25mg.
1-bromo-3,5-bis(difluoromethyl)benzene (CAS 1379370-60-1) is a chemical compound with the molecular formula C8H5BrF4 and a molecular weight of 257.02 g/mol. IUPAC name: 1-bromo-3,5-bis(difluoromethyl)benzene. InChIKey: VRYYCEFBCICHNG-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF4 |
|---|---|
| Molecular weight | 257.02 g/mol |
| IUPAC name | 1-bromo-3,5-bis(difluoromethyl)benzene |
| InChIKey | VRYYCEFBCICHNG-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)F)Br)C(F)F |
Computed by PubChem (NCBI)