Products 1383740-05-3
CAS 1383740-05-3 is the registry number for Methyl 2-chloro-4-methoxybenzo(D)thiazole-6-carboxylate. Offered by: Biosynth. Available pack sizes: 0,25g, 0,05g, 1g, 5g, 2g.
Methyl 2-chloro-4-methoxy-1,3-benzothiazole-6-carboxylate (CAS 1383740-05-3) is a chemical compound with the molecular formula C10H8ClNO3S and a molecular weight of 257.69 g/mol. IUPAC name: methyl 2-chloro-4-methoxy-1,3-benzothiazole-6-carboxylate. InChIKey: DVAQLKVNVWANSR-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO3S |
|---|---|
| Molecular weight | 257.69 g/mol |
| IUPAC name | methyl 2-chloro-4-methoxy-1,3-benzothiazole-6-carboxylate |
| InChIKey | DVAQLKVNVWANSR-UHFFFAOYSA-N |
| SMILES | COC1=C2C(=CC(=C1)C(=O)OC)SC(=N2)Cl |
Computed by PubChem (NCBI)