CAS 138528-16-2 is the registry number for N-Isoindoline-1,3-dione Mexiletine. Offered by: TRC. Available pack sizes: 250mg.
2-[1-(2,6-dimethylphenoxy)propan-2-yl]isoindole-1,3-dione (CAS 138528-16-2) is a chemical compound with the molecular formula C19H19NO3 and a molecular weight of 309.4 g/mol. IUPAC name: 2-[1-(2,6-dimethylphenoxy)propan-2-yl]isoindole-1,3-dione. InChIKey: OYVQTKYGNGXONP-UHFFFAOYSA-N.
| Molecular formula | C19H19NO3 |
|---|---|
| Molecular weight | 309.4 g/mol |
| IUPAC name | 2-[1-(2,6-dimethylphenoxy)propan-2-yl]isoindole-1,3-dione |
| InChIKey | OYVQTKYGNGXONP-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)OCC(C)N2C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)