CAS 138569-60-5 appears in our catalog under these names: 4–Methoxy–3,5–dimethylpicolinic acid, 4-Methoxy-3,5-dimethylpicolinic acid 95%, 4-Methoxy-3,5-dimethyl-2-pyridinecarboxylic acid, 95%, 95%, 4-Methoxy-3,5-dimethylpyridine-2-carboxylic acid, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
4-methoxy-3,5-dimethylpyridine-2-carboxylic acid (CAS 138569-60-5) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: 4-methoxy-3,5-dimethylpyridine-2-carboxylic acid. InChIKey: YURTZWSYMDBSIA-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | 4-methoxy-3,5-dimethylpyridine-2-carboxylic acid |
| InChIKey | YURTZWSYMDBSIA-UHFFFAOYSA-N |
| SMILES | CC1=CN=C(C(=C1OC)C)C(=O)O |
Computed by PubChem (NCBI)