CAS 138794-81-7 is the registry number for (2R,3R)-2,3-Bis(phenylmethoxy)butanedioic Acid. Offered by: TRC. Available pack sizes: 100mg, 250mg, 25mg.
(2R,3R)-2,3-bis(phenylmethoxy)butanedioic acid (CAS 138794-81-7) is a chemical compound with the molecular formula C18H18O6 and a molecular weight of 330.3 g/mol. IUPAC name: (2R,3R)-2,3-bis(phenylmethoxy)butanedioic acid. InChIKey: ZRRDKHFYTWVMFV-HZPDHXFCSA-N.
| Molecular formula | C18H18O6 |
|---|---|
| Molecular weight | 330.3 g/mol |
| IUPAC name | (2R,3R)-2,3-bis(phenylmethoxy)butanedioic acid |
| InChIKey | ZRRDKHFYTWVMFV-HZPDHXFCSA-N |
| SMILES | C1=CC=C(C=C1)CO[C@H]([C@H](C(=O)O)OCC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)