Products 1391054-65-1
CAS 1391054-65-1 appears in our catalog under these names: Benz(a)anthracene-7-methanol-13C, Benz[a]anthracene-7-methanol-13C. Offered by: TRC, MedChemExpress. Available pack sizes: 250mg, 25mg, 50 mg, 100 mg, 25 mg, 10 mg.
Benzo[a]anthracen-7-yl(113C)methanol (CAS 1391054-65-1) is a chemical compound with the molecular formula C19H14O and a molecular weight of 259.3 g/mol. IUPAC name: benzo[a]anthracen-7-yl(113C)methanol. InChIKey: FWFOOWHDKQMDKI-HNHCFKFXSA-N.
| Molecular formula | C19H14O |
|---|---|
| Molecular weight | 259.3 g/mol |
| IUPAC name | benzo[a]anthracen-7-yl(113C)methanol |
| InChIKey | FWFOOWHDKQMDKI-HNHCFKFXSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C(C4=CC=CC=C4C=C32)[13CH2]O |
Computed by PubChem (NCBI)