CAS 1391072-17-5 is the registry number for 5-Nitroisochromane, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-nitro-3,4-dihydro-1H-isochromene (CAS 1391072-17-5) is a chemical compound with the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. IUPAC name: 5-nitro-3,4-dihydro-1H-isochromene. InChIKey: IOAWMDBMHTVKKU-UHFFFAOYSA-N.
| Molecular formula | C9H9NO3 |
|---|---|
| Molecular weight | 179.17 g/mol |
| IUPAC name | 5-nitro-3,4-dihydro-1H-isochromene |
| InChIKey | IOAWMDBMHTVKKU-UHFFFAOYSA-N |
| SMILES | C1COCC2=C1C(=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)