CAS 139115-80-3 appears in our catalog under these names: 2-Bromo-3,4-dihydro-2H-1,4-benzoxazin-3-one, 95%, 2-Bromo-3,4-dihydro-2H-1,4-benzoxazin-3-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
2-bromo-4H-1,4-benzoxazin-3-one (CAS 139115-80-3) is a chemical compound with the molecular formula C8H6BrNO2 and a molecular weight of 228.04 g/mol. IUPAC name: 2-bromo-4H-1,4-benzoxazin-3-one. InChIKey: ZQJFOGYRODBABR-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO2 |
|---|---|
| Molecular weight | 228.04 g/mol |
| IUPAC name | 2-bromo-4H-1,4-benzoxazin-3-one |
| InChIKey | ZQJFOGYRODBABR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=O)C(O2)Br |
Computed by PubChem (NCBI)