Products 1391373-95-7
CAS 1391373-95-7 appears in our catalog under these names: Methyl 2-[(1r)-1-aminoethyl]benzoate hydrochloride, 95%, Methyl (R)-2-(1-aminoethyl)benzoate hcl, 95%, Methyl (R)–2–(1–aminoethyl)benzoate hcl. Offered by: Combi-blocks, AmBeed, Fluorochem, Chemat, GLPBio. Available pack sizes: 250mg, 1g, 50mg.
Methyl 2-[(1R)-1-aminoethyl]benzoate;hydrochloride (CAS 1391373-95-7) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: methyl 2-[(1R)-1-aminoethyl]benzoate;hydrochloride. InChIKey: ULMRKIOVDPKQKH-OGFXRTJISA-N.
| Molecular formula | C10H14ClNO2 |
|---|---|
| Molecular weight | 215.67 g/mol |
| IUPAC name | methyl 2-[(1R)-1-aminoethyl]benzoate;hydrochloride |
| InChIKey | ULMRKIOVDPKQKH-OGFXRTJISA-N |
| SMILES | C[C@H](C1=CC=CC=C1C(=O)OC)N.Cl |
Computed by PubChem (NCBI)