Products 1391483-59-2
CAS 1391483-59-2 appears in our catalog under these names: Methyl (S)–2–(1–aminoethyl)benzoate hcl, Methyl (s)-2-(1-aminoethyl)benzoate hydrochloride, 95%, Methyl (S)-2-(1-aminoethyl)benzoate hcl, 95%. Offered by: GLPBio, Combi-blocks, AmBeed. Available pack sizes: 100mg, 250mg, 1g.
Methyl 2-[(1S)-1-aminoethyl]benzoate;hydrochloride (CAS 1391483-59-2) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: methyl 2-[(1S)-1-aminoethyl]benzoate;hydrochloride. InChIKey: ULMRKIOVDPKQKH-FJXQXJEOSA-N.
| Molecular formula | C10H14ClNO2 |
|---|---|
| Molecular weight | 215.67 g/mol |
| IUPAC name | methyl 2-[(1S)-1-aminoethyl]benzoate;hydrochloride |
| InChIKey | ULMRKIOVDPKQKH-FJXQXJEOSA-N |
| SMILES | C[C@@H](C1=CC=CC=C1C(=O)OC)N.Cl |
Computed by PubChem (NCBI)