CAS 1391737-98-6 appears in our catalog under these names: 5-Benzyl-2-bromopyridine, 95%, 5-Benzyl-2-bromopyridine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
5-benzyl-2-bromopyridine (CAS 1391737-98-6) is a chemical compound with the molecular formula C12H10BrN and a molecular weight of 248.12 g/mol. IUPAC name: 5-benzyl-2-bromopyridine. InChIKey: LPTLXDMSDACHNL-UHFFFAOYSA-N.
| Molecular formula | C12H10BrN |
|---|---|
| Molecular weight | 248.12 g/mol |
| IUPAC name | 5-benzyl-2-bromopyridine |
| InChIKey | LPTLXDMSDACHNL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=CN=C(C=C2)Br |
Computed by PubChem (NCBI)