Products 1392476-08-2
CAS 1392476-08-2 is the registry number for rel-(3S)-N-((9H-Fluoren-9-ylmethoxy)carbonyl)-3-hydroxy-D-norvaline. Offered by: TRC. Available pack sizes: 100mg.
(2S,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxypentanoic acid (CAS 1392476-08-2) is a chemical compound with the molecular formula C20H21NO5 and a molecular weight of 355.4 g/mol. IUPAC name: (2S,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxypentanoic acid. InChIKey: VSKJOSVYDOHRGI-MSOLQXFVSA-N.
| Molecular formula | C20H21NO5 |
|---|---|
| Molecular weight | 355.4 g/mol |
| IUPAC name | (2S,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxypentanoic acid |
| InChIKey | VSKJOSVYDOHRGI-MSOLQXFVSA-N |
| SMILES | CC[C@H]([C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)O |
Computed by PubChem (NCBI)