CAS 139264-66-7 appears in our catalog under these names: Zolmitriptan Impurity 21, Rn(+)-4-(4-nitrobenzyl)-2-oxazolidinone. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 1g.
(4R)-4-[(4-nitrophenyl)methyl]-1,3-oxazolidin-2-one (CAS 139264-66-7) is a chemical compound with the molecular formula C10H10N2O4 and a molecular weight of 222.20 g/mol. IUPAC name: (4R)-4-[(4-nitrophenyl)methyl]-1,3-oxazolidin-2-one. InChIKey: CCEJPIYBVGYGEM-MRVPVSSYSA-N.
| Molecular formula | C10H10N2O4 |
|---|---|
| Molecular weight | 222.20 g/mol |
| IUPAC name | (4R)-4-[(4-nitrophenyl)methyl]-1,3-oxazolidin-2-one |
| InChIKey | CCEJPIYBVGYGEM-MRVPVSSYSA-N |
| SMILES | C1[C@H](NC(=O)O1)CC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)