Products 1394175-17-7
CAS 1394175-17-7 is the registry number for 1-Methyl-1H-Pyrrolo[3,2-C]Pyridine-3-Carboxylic Acid, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-methylpyrrolo[3,2-c]pyridine-3-carboxylic acid (CAS 1394175-17-7) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: 1-methylpyrrolo[3,2-c]pyridine-3-carboxylic acid. InChIKey: JCXIJCIEYHSUGB-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 1-methylpyrrolo[3,2-c]pyridine-3-carboxylic acid |
| InChIKey | JCXIJCIEYHSUGB-UHFFFAOYSA-N |
| SMILES | CN1C=C(C2=C1C=CN=C2)C(=O)O |
Computed by PubChem (NCBI)